Structure of PDB 5ety Chain B Binding Site BS02 |
|
|
Ligand ID | K56 |
InChI | InChI=1S/C24H27N5O3/c1-31-21-11-18-20(12-22(21)32-2)25-15-26-23(18)28-9-7-16(8-10-28)13-29-14-17-5-3-4-6-19(17)27-24(29)30/h3-6,11-12,15-16H,7-10,13-14H2,1-2H3,(H,27,30) |
InChIKey | GWXCGEJJQFHPPA-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | COc1cc2c(cc1OC)ncnc2N3CCC(CC3)CN4Cc5ccccc5NC4=O | CACTVS 3.385 | COc1cc2ncnc(N3CCC(CC3)CN4Cc5ccccc5NC4=O)c2cc1OC |
|
Formula | C24 H27 N5 O3 |
Name | 3-[[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]methyl]-1,4-dihydroquinazolin-2-one |
ChEMBL | CHEMBL4285233 |
DrugBank | |
ZINC | ZINC000196129219
|
PDB chain | 5ety Chain B Residue 1402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|