Structure of PDB 5e5i Chain B Binding Site BS02 |
|
|
Ligand ID | 5JV |
InChI | InChI=1S/C13H17N2O7P/c1-8(3-4-12(16)17)14-6-11-10(7-22-23(19,20)21)5-15-9(2)13(11)18/h5-6,18H,1,3-4,7H2,2H3,(H,16,17)(H2,19,20,21)/b14-6+ |
InChIKey | HRCALJQKZAULQS-MKMNVTDBSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1ncc(CO[P](O)(O)=O)c(C=NC(=C)CCC(O)=O)c1O | OpenEye OEToolkits 1.9.2 | Cc1c(c(c(cn1)COP(=O)(O)O)C=NC(=C)CCC(=O)O)O | OpenEye OEToolkits 1.9.2 | Cc1c(c(c(cn1)COP(=O)(O)O)/C=N/C(=C)CCC(=O)O)O | ACDLabs 12.01 | O=C(O)CC/C(N=C\c1c(cnc(c1O)C)COP(O)(O)=O)=C |
|
Formula | C13 H17 N2 O7 P |
Name | 4-[(E)-({3-hydroxy-2-methyl-5-[(phosphonooxy)methyl]pyridin-4-yl}methylidene)amino]pent-4-enoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584904782
|
PDB chain | 5e5i Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|