Structure of PDB 5e14 Chain B Binding Site BS02 |
|
|
Ligand ID | 5KB |
InChI | InChI=1S/C25H24O2/c26-23-13-9-19(10-14-23)25(20-11-15-24(27)16-12-20)22-8-4-7-21(17-22)18-5-2-1-3-6-18/h1-3,5-6,9-16,21,26-27H,4,7-8,17H2/t21-/m1/s1 |
InChIKey | VCHVPGQUQBYGKQ-OAQYLSRUSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Oc1ccc(cc1)C(=C2CCC[CH](C2)c3ccccc3)c4ccc(O)cc4 | OpenEye OEToolkits 1.9.2 | c1ccc(cc1)C2CCCC(=C(c3ccc(cc3)O)c4ccc(cc4)O)C2 | CACTVS 3.385 | Oc1ccc(cc1)C(=C2CCC[C@H](C2)c3ccccc3)c4ccc(O)cc4 | ACDLabs 12.01 | Oc1ccc(cc1)/C(c2ccc(O)cc2)=C3/CC(CCC3)c4ccccc4 | OpenEye OEToolkits 1.9.2 | c1ccc(cc1)[C@@H]2CCCC(=C(c3ccc(cc3)O)c4ccc(cc4)O)C2 |
|
Formula | C25 H24 O2 |
Name | 4,4'-{[(3R)-3-phenylcyclohexylidene]methanediyl}diphenol |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584904939
|
PDB chain | 5e14 Chain B Residue 901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|