Structure of PDB 5byn Chain B Binding Site BS02 |
|
|
Ligand ID | 4WM |
InChI | InChI=1S/C16H31NO4Se/c1-16(2,3)21-15(20)17-12(9-10-14(18)19)11-22-13-7-5-4-6-8-13/h5,7,12-15,17-20H,4,6,8-11H2,1-3H3/t12-,13-,15+/m1/s1 |
InChIKey | UREOHWFKMYYNAM-NFAWXSAZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CC(C)(C)O[C@@H](N[C@H](CCC(O)O)C[Se][C@H]1CCCC=C1)O | CACTVS 3.385 | CC(C)(C)O[CH](O)N[CH](CCC(O)O)C[Se][CH]1CCCC=C1 | ACDLabs 12.01 | N(C(O)OC(C)(C)C)C(CCC(O)O)C[Se]C1C=CCCC1 | OpenEye OEToolkits 1.9.2 | CC(C)(C)OC(NC(CCC(O)O)C[Se]C1CCCC=C1)O | CACTVS 3.385 | CC(C)(C)O[C@H](O)N[C@H](CCC(O)O)C[Se][C@H]1CCCC=C1 |
|
Formula | C16 H31 N O4 Se |
Name | (4R)-4-{[(S)-tert-butoxy(hydroxy)methyl]amino}-5-[(1S)-cyclohex-2-en-1-ylselanyl]pentane-1,1-diol |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5byn Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|