Structure of PDB 5bt4 Chain B Binding Site BS02 |
|
|
Ligand ID | 2LO |
InChI | InChI=1S/C28H33ClN4O3/c1-18(32-11-13-35-14-12-32)17-33-25-8-7-22(28-19(2)31-36-20(28)3)16-24(25)30-27(33)10-6-21-5-9-26(34-4)23(29)15-21/h5,7-9,15-16,18H,6,10-14,17H2,1-4H3/t18-/m0/s1 |
InChIKey | GEPYBHCJBORHCE-SFHVURJKSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Clc1c(OC)ccc(c1)CCc4nc3cc(c2c(onc2C)C)ccc3n4CC(N5CCOCC5)C | OpenEye OEToolkits 1.7.6 | Cc1c(c(on1)C)c2ccc3c(c2)nc(n3C[C@H](C)N4CCOCC4)CCc5ccc(c(c5)Cl)OC | CACTVS 3.385 | COc1ccc(CCc2nc3cc(ccc3n2C[CH](C)N4CCOCC4)c5c(C)onc5C)cc1Cl | CACTVS 3.385 | COc1ccc(CCc2nc3cc(ccc3n2C[C@H](C)N4CCOCC4)c5c(C)onc5C)cc1Cl | OpenEye OEToolkits 1.7.6 | Cc1c(c(on1)C)c2ccc3c(c2)nc(n3CC(C)N4CCOCC4)CCc5ccc(c(c5)Cl)OC |
|
Formula | C28 H33 Cl N4 O3 |
Name | 2-[2-(3-chloro-4-methoxyphenyl)ethyl]-5-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(2S)-2-(morpholin-4-yl)propyl]-1H-benzimidazole |
ChEMBL | CHEMBL3622373 |
DrugBank | |
ZINC | ZINC000096170456
|
PDB chain | 5bt4 Chain C Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|