Structure of PDB 5a1l Chain B Binding Site BS02 |
|
|
Ligand ID | S2I |
InChI | InChI=1S/C22H25N5O/c28-15-5-12-24-20-16-21(26-22(25-20)19-8-3-4-11-23-19)27-13-9-17-6-1-2-7-18(17)10-14-27/h1-4,6-8,11,16,28H,5,9-10,12-15H2,(H,24,25,26) |
InChIKey | XLIJLZCIQJERJQ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OCCCNc1cc(nc(n1)c2ccccn2)N3CCc4ccccc4CC3 | OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)CCN(CC2)c3cc(nc(n3)c4ccccn4)NCCCO |
|
Formula | C22 H25 N5 O |
Name | 3-[[2-pyridin-2-yl-6-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)pyrimidin-4-yl]amino]propan-1-ol |
ChEMBL | |
DrugBank | |
ZINC | ZINC000230586442
|
PDB chain | 5a1l Chain B Residue 2267
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.14.11.68: [histone H3]-trimethyl-L-lysine(27) demethylase. |
|
|