Structure of PDB 4qsj Chain B Binding Site BS02 |
|
|
Ligand ID | EWW |
InChI | InChI=1S/C13H12ClN3O4S2/c1-7-4-12(19)17-13(16-7)22-6-10(18)8-2-3-11(9(14)5-8)23(15,20)21/h2-5H,6H2,1H3,(H2,15,20,21)(H,16,17,19) |
InChIKey | JGNLEKQOGRGZBT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC1=CC(=O)NC(=N1)SCC(=O)c2ccc(c(Cl)c2)[S](N)(=O)=O | OpenEye OEToolkits 1.7.6 | CC1=CC(=O)NC(=N1)SCC(=O)c2ccc(c(c2)Cl)S(=O)(=O)N | ACDLabs 12.01 | O=C2C=C(N=C(SCC(=O)c1ccc(c(Cl)c1)S(=O)(=O)N)N2)C |
|
Formula | C13 H12 Cl N3 O4 S2 |
Name | 2-chloro-4-{[(4-methyl-6-oxo-1,6-dihydropyrimidin-2-yl)sulfanyl]acetyl}benzenesulfonamide |
ChEMBL | CHEMBL2443194 |
DrugBank | |
ZINC | ZINC000096940231
|
PDB chain | 4qsj Chain B Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|