Structure of PDB 4ow0 Chain B Binding Site BS02 |
|
|
Ligand ID | S88 |
InChI | InChI=1S/C25H27FN2O/c1-18(23-11-5-8-20-7-2-3-10-24(20)23)28-14-12-21(13-15-28)25(29)27-17-19-6-4-9-22(26)16-19/h2-11,16,18,21H,12-15,17H2,1H3,(H,27,29)/t18-/m1/s1 |
InChIKey | XJTWGMHOQKGBDO-GOSISDBHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CC(c1cccc2c1cccc2)N3CCC(CC3)C(=O)NCc4cccc(c4)F | CACTVS 3.385 | C[CH](N1CC[CH](CC1)C(=O)NCc2cccc(F)c2)c3cccc4ccccc34 | CACTVS 3.385 | C[C@@H](N1CC[C@H](CC1)C(=O)NCc2cccc(F)c2)c3cccc4ccccc34 | ACDLabs 12.01 | Fc1cccc(c1)CNC(=O)C4CCN(C(c3c2ccccc2ccc3)C)CC4 | OpenEye OEToolkits 1.9.2 | C[C@H](c1cccc2c1cccc2)N3CCC(CC3)C(=O)NCc4cccc(c4)F |
|
Formula | C25 H27 F N2 O |
Name | N-[(3-fluorophenyl)methyl]-1-[(1R)-1-naphthalen-1-ylethyl]piperidine-4-carboxamide |
ChEMBL | CHEMBL3233815 |
DrugBank | |
ZINC | ZINC000098209392
|
PDB chain | 4ow0 Chain B Residue 902
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|