Structure of PDB 4mus Chain B Binding Site BS02 |
|
|
Ligand ID | LY0 |
InChI | InChI=1S/C6H14NO4P/c1-4(6(8)9)3-12(10,11)5(2)7/h4-5H,3,7H2,1-2H3,(H,8,9)(H,10,11)/t4-,5+/m0/s1 |
InChIKey | XXVGIEKADYFHOF-CRCLSJGQSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | C[C@@H](C[P@](=O)([C@H](C)N)O)C(=O)O | CACTVS 3.352 | C[CH](N)[P](O)(=O)C[CH](C)C(O)=O | CACTVS 3.352 | C[C@H](N)[P](O)(=O)C[C@H](C)C(O)=O | OpenEye OEToolkits 1.7.0 | CC(CP(=O)(C(C)N)O)C(=O)O |
|
Formula | C6 H14 N O4 P |
Name | (2R)-3-[(R)-[(1R)-1-aminoethyl](hydroxy)phosphoryl]-2-methylpropanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000025109103
|
PDB chain | 4mus Chain B Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|