Structure of PDB 4jyi Chain B Binding Site BS02 |
|
|
Ligand ID | JYI |
InChI | InChI=1S/C27H23ClO2/c1-27(2)15-14-22(19-6-4-3-5-7-19)23-16-18(9-13-24(23)27)8-10-20-11-12-21(26(29)30)17-25(20)28/h3-14,16-17H,15H2,1-2H3,(H,29,30)/b10-8+ |
InChIKey | FRTYVAKGTFXRNY-CSKARUKUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC1(CC=C(c2c1ccc(c2)C=Cc3ccc(cc3Cl)C(=O)O)c4ccccc4)C | OpenEye OEToolkits 1.7.6 | CC1(CC=C(c2c1ccc(c2)/C=C/c3ccc(cc3Cl)C(=O)O)c4ccccc4)C | CACTVS 3.370 | CC1(C)CC=C(c2ccccc2)c3cc(C=Cc4ccc(cc4Cl)C(O)=O)ccc13 | CACTVS 3.370 | CC1(C)CC=C(c2ccccc2)c3cc(\C=C\c4ccc(cc4Cl)C(O)=O)ccc13 | ACDLabs 12.01 | O=C(O)c1ccc(c(Cl)c1)\C=C\c4ccc2c(C(=CCC2(C)C)c3ccccc3)c4 |
|
Formula | C27 H23 Cl O2 |
Name | 3-chloro-4-[(E)-2-(5,5-dimethyl-8-phenyl-5,6-dihydronaphthalen-2-yl)ethenyl]benzoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000065731567
|
PDB chain | 4jyi Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|