Structure of PDB 4i73 Chain B Binding Site BS02 |
|
|
Ligand ID | MBY |
InChI | InChI=1S/C12H15N3O4S/c16-3-7-10(18)8(17)2-15(7)1-6-4-20-11-9(6)13-5-14-12(11)19/h4-5,7-8,10,16-18H,1-3H2,(H,13,14,19)/t7-,8+,10-/m1/s1 |
InChIKey | UZJHCHSHAYEOTK-KHQFGBGNSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | OC[C@@H]1[C@@H](O)[C@@H](O)CN1Cc2csc3c(O)ncnc23 | OpenEye OEToolkits 1.7.6 | c1c(c2c(s1)c(ncn2)O)CN3CC(C(C3CO)O)O | CACTVS 3.370 | OC[CH]1[CH](O)[CH](O)CN1Cc2csc3c(O)ncnc23 | OpenEye OEToolkits 1.7.6 | c1c(c2c(s1)c(ncn2)O)CN3C[C@@H]([C@@H]([C@H]3CO)O)O | ACDLabs 12.01 | n1c(O)c2scc(c2nc1)CN3C(CO)C(O)C(O)C3 |
|
Formula | C12 H15 N3 O4 S |
Name | (2R,3R,4S)-2-(hydroxymethyl)-1-[(4-hydroxythieno[3,2-d]pyrimidin-7-yl)methyl]pyrrolidine-3,4-diol |
ChEMBL | CHEMBL1256031 |
DrugBank | |
ZINC | ZINC000064539570
|
PDB chain | 4i73 Chain B Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.2.2.1: purine nucleosidase. |
|
|
|