Structure of PDB 4hog Chain B Binding Site BS02 |
|
|
Ligand ID | 18H |
InChI | InChI=1S/C22H22N4O/c1-14(9-11-19-15(2)25-22(24)26-21(19)23)18-12-10-17(13-20(18)27-3)16-7-5-4-6-8-16/h4-8,10,12-14H,1-3H3,(H4,23,24,25,26)/t14-/m0/s1 |
InChIKey | DATCFVVEPPDLRQ-AWEZNQCLSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | C(#CC(c2ccc(c1ccccc1)cc2OC)C)c3c(nc(nc3C)N)N | OpenEye OEToolkits 1.7.6 | Cc1c(c(nc(n1)N)N)C#C[C@H](C)c2ccc(cc2OC)c3ccccc3 | CACTVS 3.370 | COc1cc(ccc1[CH](C)C#Cc2c(C)nc(N)nc2N)c3ccccc3 | OpenEye OEToolkits 1.7.6 | Cc1c(c(nc(n1)N)N)C#CC(C)c2ccc(cc2OC)c3ccccc3 | CACTVS 3.370 | COc1cc(ccc1[C@@H](C)C#Cc2c(C)nc(N)nc2N)c3ccccc3 |
|
Formula | C22 H22 N4 O |
Name | 5-[3-(2-methoxy-4-phenylphenyl)but-1-yn-1-yl]-6-methylpyrimidine-2,4-diamine; 5-[(3S)-3-(3-methoxybiphenyl-4-yl)but-1-yn-1-yl]-6-methylpyrimidine-2,4-diamine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000064503655
|
PDB chain | 4hog Chain B Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|