Structure of PDB 4hgt Chain B Binding Site BS02 |
|
|
Ligand ID | 15G |
InChI | InChI=1S/C20H17F2N3O3/c1-27-19-9-24-11(10-28-12-2-3-15(21)16(22)7-12)6-13(19)18-8-14-17(25-18)4-5-23-20(14)26/h2-3,6-9,25H,4-5,10H2,1H3,(H,23,26) |
InChIKey | GMIKNOQZLHKCFH-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | COc1cnc(cc1c2cc3c([nH]2)CCNC3=O)COc4ccc(c(c4)F)F | CACTVS 3.370 | COc1cnc(COc2ccc(F)c(F)c2)cc1c3[nH]c4CCNC(=O)c4c3 | ACDLabs 12.01 | Fc4ccc(OCc3ncc(OC)c(c2cc1C(=O)NCCc1n2)c3)cc4F |
|
Formula | C20 H17 F2 N3 O3 |
Name | 2-{2-[(3,4-difluorophenoxy)methyl]-5-methoxypyridin-4-yl}-1,5,6,7-tetrahydro-4H-pyrrolo[3,2-c]pyridin-4-one |
ChEMBL | CHEMBL2203563 |
DrugBank | |
ZINC | ZINC000095558235
|
PDB chain | 4hgt Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
D128 K130 |
Catalytic site (residue number reindexed from 1) |
D116 K118 |
Enzyme Commision number |
2.7.11.1: non-specific serine/threonine protein kinase. 2.7.11.26: [tau protein] kinase. |
|
|
|