Structure of PDB 4h84 Chain B Binding Site BS02 |
|
|
Ligand ID | Y38 |
InChI | InChI=1S/C26H28N2O5S/c1-19(2)24(26(30)31)28(18-17-27-25(29)22-11-7-4-8-12-22)34(32,33)23-15-13-21(14-16-23)20-9-5-3-6-10-20/h3-16,19,24H,17-18H2,1-2H3,(H,27,29)(H,30,31)/t24-/m1/s1 |
InChIKey | BKYHPXRQAHYJBN-XMMPIXPASA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CC(C)[CH](N(CCNC(=O)c1ccccc1)[S](=O)(=O)c2ccc(cc2)c3ccccc3)C(O)=O | CACTVS 3.370 | CC(C)[C@@H](N(CCNC(=O)c1ccccc1)[S](=O)(=O)c2ccc(cc2)c3ccccc3)C(O)=O | ACDLabs 12.01 | O=S(=O)(N(C(C(=O)O)C(C)C)CCNC(=O)c1ccccc1)c3ccc(c2ccccc2)cc3 | OpenEye OEToolkits 1.7.6 | CC(C)C(C(=O)O)N(CCNC(=O)c1ccccc1)S(=O)(=O)c2ccc(cc2)c3ccccc3 | OpenEye OEToolkits 1.7.6 | CC(C)[C@H](C(=O)O)N(CCNC(=O)c1ccccc1)S(=O)(=O)c2ccc(cc2)c3ccccc3 |
|
Formula | C26 H28 N2 O5 S |
Name | N-[2-(benzoylamino)ethyl]-N-(biphenyl-4-ylsulfonyl)-D-valine |
ChEMBL | CHEMBL3971551 |
DrugBank | |
ZINC | ZINC000095920991
|
PDB chain | 4h84 Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|