Structure of PDB 4cqf Chain B Binding Site BS02 |
|
|
Ligand ID | 9Z8 |
InChI | InChI=1S/C14H20N2O2S/c17-13(16-12-7-3-1-4-8-12)9-5-2-6-10-15-14(18)11-19/h1,3-4,7-8,19H,2,5-6,9-11H2,(H,15,18)(H,16,17) |
InChIKey | ICMLRCZXRBTKLJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(Nc1ccccc1)CCCCCNC(=O)CS | OpenEye OEToolkits 1.7.6 | c1ccc(cc1)NC(=O)CCCCCNC(=O)CS | CACTVS 3.385 | SCC(=O)NCCCCCC(=O)Nc1ccccc1 |
|
Formula | C14 H20 N2 O2 S |
Name | 6-(2-Mercaptoacetylamino)-N-phenylhexanamide |
ChEMBL | CHEMBL178727 |
DrugBank | |
ZINC | ZINC000013609328
|
PDB chain | 4cqf Chain B Residue 700
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.5.1.98: histone deacetylase. |
|
|
|