Structure of PDB 4cm5 Chain B Binding Site BS02 |
|
|
Ligand ID | NWJ |
InChI | InChI=1S/C18H16N6O/c19-9-13-14-16(21-15(13)12-5-3-4-11(8-12)10-25)22-18(20)23-17(14)24-6-1-2-7-24/h3-5,8,10H,1-2,6-7H2,(H3,20,21,22,23) |
InChIKey | YJUYKLYWYFTFQN-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | c1cc(cc(c1)c2c(c3c([nH]2)nc(nc3N4CCCC4)N)C#N)C=O | CACTVS 3.385 | Nc1nc2[nH]c(c3cccc(C=O)c3)c(C#N)c2c(n1)N4CCCC4 | ACDLabs 12.01 | O=Cc1cccc(c1)c3c(C#N)c2c(nc(nc2n3)N)N4CCCC4 |
|
Formula | C18 H16 N6 O |
Name | 2-amino-6-(3-formylphenyl)-4-(pyrrolidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile |
ChEMBL | CHEMBL3318494 |
DrugBank | |
ZINC | ZINC000263621280
|
PDB chain | 4cm5 Chain B Residue 1270
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|