Structure of PDB 4ck3 Chain B Binding Site BS02 |
|
|
Ligand ID | K1T |
InChI | InChI=1S/C19H28N2O5/c1-12(2)8-13(10-21-16(22)4-3-7-20)9-14-5-6-15-18(26-11-25-15)17(14)19(23)24/h5-6,12-13H,3-4,7-11,20H2,1-2H3,(H,21,22)(H,23,24)/t13-/m0/s1 |
InChIKey | RVKWMXPCIVFAJW-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)C[C@H](CNC(=O)CCCN)Cc1ccc2OCOc2c1C(O)=O | OpenEye OEToolkits 1.7.6 | CC(C)CC(Cc1ccc2c(c1C(=O)O)OCO2)CNC(=O)CCCN | ACDLabs 12.01 | O=C(O)c1c(ccc2OCOc12)CC(CC(C)C)CNC(=O)CCCN | CACTVS 3.385 | CC(C)C[CH](CNC(=O)CCCN)Cc1ccc2OCOc2c1C(O)=O | OpenEye OEToolkits 1.7.6 | CC(C)C[C@@H](Cc1ccc2c(c1C(=O)O)OCO2)CNC(=O)CCCN |
|
Formula | C19 H28 N2 O5 |
Name | 5-[(2S)-2-{[(4-aminobutanoyl)amino]methyl}-4-methylpentyl]-1,3-benzodioxole-4-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921001
|
PDB chain | 4ck3 Chain B Residue 1216
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|