Structure of PDB 4cjp Chain B Binding Site BS02 |
|
|
Ligand ID | 4D2 |
InChI | InChI=1S/C21H24N2O5/c1-13(2)8-14(10-23-20(24)16-4-3-7-22-11-16)9-15-5-6-17-19(28-12-27-17)18(15)21(25)26/h3-7,11,13-14H,8-10,12H2,1-2H3,(H,23,24)(H,25,26)/t14-/m0/s1 |
InChIKey | LRIOQCGZQZMXSL-AWEZNQCLSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)C[CH](CNC(=O)c1cccnc1)Cc2ccc3OCOc3c2C(O)=O | OpenEye OEToolkits 1.9.2 | CC(C)CC(Cc1ccc2c(c1C(=O)O)OCO2)CNC(=O)c3cccnc3 | ACDLabs 12.01 | O=C(O)c1c(ccc2OCOc12)CC(CC(C)C)CNC(=O)c3cccnc3 | OpenEye OEToolkits 1.9.2 | CC(C)C[C@@H](Cc1ccc2c(c1C(=O)O)OCO2)CNC(=O)c3cccnc3 | CACTVS 3.385 | CC(C)C[C@H](CNC(=O)c1cccnc1)Cc2ccc3OCOc3c2C(O)=O |
|
Formula | C21 H24 N2 O5 |
Name | 5-[(2S)-4-methyl-2-[(pyridin-3-ylcarbonylamino)methyl]pentyl]-1,3-benzodioxole-4-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920995
|
PDB chain | 4cjp Chain B Residue 1214
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|