Structure of PDB 4cgf Chain B Binding Site BS02 |
|
|
Ligand ID | UJ6 |
InChI | InChI=1S/C17H13NO5/c19-16-11(10-3-1-2-4-12(10)18-16)7-9-5-6-13-15(23-8-22-13)14(9)17(20)21/h1-6,11H,7-8H2,(H,18,19)(H,20,21)/t11-/m0/s1 |
InChIKey | KPBCEHCDLYYWDE-NSHDSACASA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)c1c(C[CH]2C(=O)Nc3ccccc23)ccc4OCOc14 | OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)[C@@H](C(=O)N2)Cc3ccc4c(c3C(=O)O)OCO4 | CACTVS 3.385 | OC(=O)c1c(C[C@@H]2C(=O)Nc3ccccc23)ccc4OCOc14 | ACDLabs 12.01 | O=C2Nc1ccccc1C2Cc3ccc4OCOc4c3C(=O)O | OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)C(C(=O)N2)Cc3ccc4c(c3C(=O)O)OCO4 |
|
Formula | C17 H13 N O5 |
Name | 5-{[(3S)-2-oxo-2,3-dihydro-1H-indol-3-yl]methyl}-1,3-benzodioxole-4-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920892
|
PDB chain | 4cgf Chain B Residue 1219
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|