Structure of PDB 4buy Chain B Binding Site BS02 |
|
|
Ligand ID | F37 |
InChI | InChI=1S/C18H14N4O3/c1-18(16(24)21-17(25)22-18)11-8-6-10(7-9-11)14-19-13-5-3-2-4-12(13)15(23)20-14/h2-9H,1H3,(H,19,20,23)(H2,21,22,24,25)/t18-/m0/s1 |
InChIKey | SBPOIJPCJCMVPV-SFHVURJKSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C1c4ccccc4N=C(N1)c2ccc(cc2)C3(C(=O)NC(=O)N3)C | CACTVS 3.385 | C[C@]1(NC(=O)NC1=O)c2ccc(cc2)C3=Nc4ccccc4C(=O)N3 | OpenEye OEToolkits 1.9.2 | CC1(C(=O)NC(=O)N1)c2ccc(cc2)C3=Nc4ccccc4C(=O)N3 | CACTVS 3.385 | C[C]1(NC(=O)NC1=O)c2ccc(cc2)C3=Nc4ccccc4C(=O)N3 | OpenEye OEToolkits 1.9.2 | C[C@@]1(C(=O)NC(=O)N1)c2ccc(cc2)C3=Nc4ccccc4C(=O)N3 |
|
Formula | C18 H14 N4 O3 |
Name | (5S)-5-methyl-5-[4-(4-oxidanylidene-3H-quinazolin-2-yl)phenyl]imidazolidine-2,4-dione |
ChEMBL | |
DrugBank | |
ZINC | ZINC000053845960
|
PDB chain | 4buy Chain B Residue 2164
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|