Structure of PDB 4bn5 Chain B Binding Site BS02 |
|
|
Ligand ID | SR7 |
InChI | InChI=1S/C25H23N7OS/c33-24(22-13-27-20-7-3-4-8-21(20)28-22)29-19-6-2-1-5-18(19)23-15-32-17(16-34-25(32)30-23)14-31-11-9-26-10-12-31/h1-8,13,15-16,26H,9-12,14H2,(H,29,33) |
InChIKey | IASPBORHOMBZMY-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(c1nc2c(nc1)cccc2)Nc6c(c3nc4scc(n4c3)CN5CCNCC5)cccc6 | OpenEye OEToolkits 1.7.6 | c1ccc(c(c1)c2cn3c(csc3n2)CN4CCNCC4)NC(=O)c5cnc6ccccc6n5 | CACTVS 3.370 | O=C(Nc1ccccc1c2cn3c(CN4CCNCC4)csc3n2)c5cnc6ccccc6n5 |
|
Formula | C25 H23 N7 O S |
Name | N-{2-[3-(piperazin-1-ylmethyl)imidazo[2,1-b][1,3]thiazol-6-yl]phenyl}quinoxaline-2-carboxamide |
ChEMBL | CHEMBL257991 |
DrugBank | DB17057 |
ZINC | ZINC000029043612
|
PDB chain | 4bn5 Chain B Residue 1396
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|