Structure of PDB 4bjk Chain B Binding Site BS02 |
|
|
Ligand ID | 18I |
InChI | InChI=1S/C29H22F2N4O2/c30-21-5-3-4-18(14-21)19-8-9-24(25(31)15-19)28(36)35-27(29(37)34-22-10-12-32-13-11-22)16-20-17-33-26-7-2-1-6-23(20)26/h1-15,17,27,33H,16H2,(H,35,36)(H,32,34,37)/t27-/m0/s1 |
InChIKey | QLYGOABRPGBQNG-MHZLTWQESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)c(c[nH]2)C[C@@H](C(=O)Nc3ccncc3)NC(=O)c4ccc(cc4F)c5cccc(c5)F | CACTVS 3.370 | Fc1cccc(c1)c2ccc(C(=O)N[C@@H](Cc3c[nH]c4ccccc34)C(=O)Nc5ccncc5)c(F)c2 | OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)c(c[nH]2)CC(C(=O)Nc3ccncc3)NC(=O)c4ccc(cc4F)c5cccc(c5)F | CACTVS 3.370 | Fc1cccc(c1)c2ccc(C(=O)N[CH](Cc3c[nH]c4ccccc34)C(=O)Nc5ccncc5)c(F)c2 | ACDLabs 12.01 | Fc1cccc(c1)c2ccc(c(F)c2)C(=O)NC(C(=O)Nc3ccncc3)Cc5c4ccccc4nc5 |
|
Formula | C29 H22 F2 N4 O2 |
Name | 3,3'-difluoro-N-[(2S)-3-(1H-indol-3-yl)-1-oxo-1-(pyridin-4-ylamino)propan-2-yl]biphenyl-4-carboxamide |
ChEMBL | CHEMBL2431546 |
DrugBank | |
ZINC | ZINC000095920897
|
PDB chain | 4bjk Chain B Residue 1460
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
T295 F415 C422 |
Catalytic site (residue number reindexed from 1) |
T267 F387 C394 |
Enzyme Commision number |
1.14.13.70: Transferred entry: 1.14.14.154. |
|
|
|