Structure of PDB 4a6s Chain B Binding Site BS02 |
|
|
Ligand ID | GS9 |
InChI | InChI=1S/C16H18O5S/c17-8-12-13(18)14(19)15(20)16(21-12)22-11-6-5-9-3-1-2-4-10(9)7-11/h1-7,12-20H,8H2/t12-,13+,14+,15-,16+/m1/s1 |
InChIKey | UTPJJZURVZIAID-CWVYHPPDSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC[CH]1O[CH](Sc2ccc3ccccc3c2)[CH](O)[CH](O)[CH]1O | CACTVS 3.385 | OC[C@H]1O[C@@H](Sc2ccc3ccccc3c2)[C@H](O)[C@@H](O)[C@H]1O | ACDLabs 12.01 | S(c1ccc2c(c1)cccc2)C3OC(C(O)C(O)C3O)CO | OpenEye OEToolkits 1.9.2 | c1ccc2cc(ccc2c1)SC3C(C(C(C(O3)CO)O)O)O | OpenEye OEToolkits 1.9.2 | c1ccc2cc(ccc2c1)S[C@H]3[C@@H]([C@H]([C@H]([C@H](O3)CO)O)O)O |
|
Formula | C16 H18 O5 S |
Name | naphthalen-2-yl 1-thio-beta-D-galactopyranoside; naphthalen-2-yl 1-thio-beta-D-galactoside; naphthalen-2-yl 1-thio-D-galactoside; naphthalen-2-yl 1-thio-galactoside |
ChEMBL | CHEMBL3590184 |
DrugBank | |
ZINC | ZINC000095920922
|
PDB chain | 4a6s Chain B Residue 1123
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|