Structure of PDB 3zyh Chain B Binding Site BS02 |
|
|
Ligand ID | G0S |
InChI | InChI=1S/C9H16O7S/c10-3-4-6(13)7(14)8(15)9(16-4)17-2-1-5(11)12/h4,6-10,13-15H,1-3H2,(H,11,12)/t4-,6+,7+,8-,9+/m1/s1 |
InChIKey | XMQYQVUZHDCFEM-MRCFXUCSSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC[CH]1O[CH](SCCC(O)=O)[CH](O)[CH](O)[CH]1O | CACTVS 3.385 | OC[C@H]1O[C@@H](SCCC(O)=O)[C@H](O)[C@@H](O)[C@H]1O | ACDLabs 12.01 | O=C(O)CCSC1OC(C(O)C(O)C1O)CO | OpenEye OEToolkits 1.9.2 | C(CSC1C(C(C(C(O1)CO)O)O)O)C(=O)O | OpenEye OEToolkits 1.9.2 | C(CS[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO)O)O)O)C(=O)O |
|
Formula | C9 H16 O7 S |
Name | 3-(beta-D-galactopyranosylthio)propanoic acid; 3-(beta-D-galactosylthio)propanoic acid; 3-(D-galactosylthio)propanoic acid; 3-(galactosylthio)propanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000059874097
|
PDB chain | 3zyh Chain B Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|