Structure of PDB 3zhy Chain B Binding Site BS02 |
|
|
Ligand ID | FM6 |
InChI | InChI=1S/C16H16Cl2NO5P/c17-13-7-6-12(10-14(13)18)15(25(22,23)24)8-9-19(21)16(20)11-4-2-1-3-5-11/h1-7,10,15,21H,8-9H2,(H2,22,23,24)/t15-/m0/s1 |
InChIKey | ZQCVCGYWPNFEAH-HNNXBMFYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | c1ccc(cc1)C(=O)N(CCC(c2ccc(c(c2)Cl)Cl)P(=O)(O)O)O | OpenEye OEToolkits 1.9.2 | c1ccc(cc1)C(=O)N(CC[C@@H](c2ccc(c(c2)Cl)Cl)P(=O)(O)O)O | CACTVS 3.385 | ON(CC[C@@H](c1ccc(Cl)c(Cl)c1)[P](O)(O)=O)C(=O)c2ccccc2 | CACTVS 3.385 | ON(CC[CH](c1ccc(Cl)c(Cl)c1)[P](O)(O)=O)C(=O)c2ccccc2 | ACDLabs 12.01 | Clc1ccc(cc1Cl)C(CCN(O)C(=O)c2ccccc2)P(=O)(O)O |
|
Formula | C16 H16 Cl2 N O5 P |
Name | [(1S)-1-(3,4-dichlorophenyl)-3-[oxidanyl(phenylcarbonyl)amino]propyl]phosphonic acid; [3-[benzoyl(hydroxy)amino]-1-(3,4-dichlorophenyl)propyl]phosphonic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000096273640
|
PDB chain | 3zhy Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.1.1.267: 1-deoxy-D-xylulose-5-phosphate reductoisomerase. |
|
|
Biological Process |
GO:0008299 |
isoprenoid biosynthetic process |
GO:0019288 |
isopentenyl diphosphate biosynthetic process, methylerythritol 4-phosphate pathway |
GO:0051483 |
terpenoid biosynthetic process, mevalonate-independent |
GO:0051484 |
isopentenyl diphosphate biosynthetic process, methylerythritol 4-phosphate pathway involved in terpenoid biosynthetic process |
|
|