Structure of PDB 3zgl Chain B Binding Site BS02 |
|
|
Ligand ID | 10E |
InChI | InChI=1S/C5H13NO7P2/c1-5(4-6)2-3-12-15(10,11)13-14(7,8)9/h2H,3-4,6H2,1H3,(H,10,11)(H2,7,8,9)/b5-2+ |
InChIKey | SZAMOALLMIAULD-GORDUTHDSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C/C(=C\COP(=O)(O)OP(=O)(O)O)/CN | ACDLabs 12.01 | O=P(O)(O)OP(=O)(OC\C=C(/C)CN)O | OpenEye OEToolkits 1.7.6 | CC(=CCOP(=O)(O)OP(=O)(O)O)CN | CACTVS 3.370 | CC(CN)=CCO[P](O)(=O)O[P](O)(O)=O | CACTVS 3.370 | C\C(CN)=C/CO[P](O)(=O)O[P](O)(O)=O |
|
Formula | C5 H13 N O7 P2 |
Name | (2E)-4-amino-3-methylbut-2-en-1-yl trihydrogen diphosphate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098207908
|
PDB chain | 3zgl Chain B Residue 1311
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.17.7.4: 4-hydroxy-3-methylbut-2-enyl diphosphate reductase. |
|
|
|