Structure of PDB 3w1r Chain B Binding Site BS02 |
|
|
Ligand ID | MRO |
InChI | InChI=1S/C13H12N2O4/c16-11-9(7-6-8-4-2-1-3-5-8)10(12(17)18)14-13(19)15-11/h1-5H,6-7H2,(H,17,18)(H2,14,15,16,19) |
InChIKey | AKYNBWGDBBWTJA-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | OC(=O)C1=C(CCc2ccccc2)C(=O)NC(=O)N1 | OpenEye OEToolkits 1.7.6 | c1ccc(cc1)CCC2=C(NC(=O)NC2=O)C(=O)O | ACDLabs 12.01 | O=C1NC(C(=O)O)=C(C(=O)N1)CCc2ccccc2 |
|
Formula | C13 H12 N2 O4 |
Name | 2,6-dioxo-5-(2-phenylethyl)-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid |
ChEMBL | CHEMBL3990479 |
DrugBank | |
ZINC | ZINC000098209189
|
PDB chain | 3w1r Chain B Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|