Structure of PDB 3vs1 Chain B Binding Site BS02 |
|
|
Ligand ID | VSA |
InChI | InChI=1S/C24H24N6O/c25-22-21-20(14-30(19-8-4-5-9-19)23(21)27-15-26-22)16-10-12-18(13-11-16)29-24(31)28-17-6-2-1-3-7-17/h1-3,6-7,10-15,19H,4-5,8-9H2,(H2,25,26,27)(H2,28,29,31) |
InChIKey | WFPSCBQARGWGBI-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | Nc1ncnc2n(cc(c3ccc(NC(=O)Nc4ccccc4)cc3)c12)C5CCCC5 | OpenEye OEToolkits 1.7.6 | c1ccc(cc1)NC(=O)Nc2ccc(cc2)c3cn(c4c3c(ncn4)N)C5CCCC5 | ACDLabs 12.01 | O=C(Nc1ccccc1)Nc5ccc(c3c2c(ncnc2n(c3)C4CCCC4)N)cc5 |
|
Formula | C24 H24 N6 O |
Name | 1-[4-(4-amino-7-cyclopentyl-7H-pyrrolo[2,3-d]pyrimidin-5-yl)phenyl]-3-phenylurea |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920873
|
PDB chain | 3vs1 Chain B Residue 602
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|