Structure of PDB 3u1y Chain B Binding Site BS02 |
|
|
Ligand ID | 03I |
InChI | InChI=1S/C25H34N2O6S/c1-25(24(28)26-29,34(2,30)31)13-12-20-4-6-21(7-5-20)22-8-10-23(11-9-22)33-17-3-14-27-15-18-32-19-16-27/h4-11,29H,3,12-19H2,1-2H3,(H,26,28)/t25-/m1/s1 |
InChIKey | GGIDQMXKOSYOHO-RUZDIDTESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | C[C](CCc1ccc(cc1)c2ccc(OCCCN3CCOCC3)cc2)(C(=O)NO)[S](C)(=O)=O | CACTVS 3.370 | C[C@@](CCc1ccc(cc1)c2ccc(OCCCN3CCOCC3)cc2)(C(=O)NO)[S](C)(=O)=O | ACDLabs 12.01 | O=S(=O)(C)C(C(=O)NO)(C)CCc1ccc(cc1)c3ccc(OCCCN2CCOCC2)cc3 | OpenEye OEToolkits 1.7.2 | CC(CCc1ccc(cc1)c2ccc(cc2)OCCCN3CCOCC3)(C(=O)NO)S(=O)(=O)C | OpenEye OEToolkits 1.7.2 | C[C@@](CCc1ccc(cc1)c2ccc(cc2)OCCCN3CCOCC3)(C(=O)NO)S(=O)(=O)C |
|
Formula | C25 H34 N2 O6 S |
Name | (2R)-N-hydroxy-2-methyl-2-(methylsulfonyl)-4-{4'-[3-(morpholin-4-yl)propoxy]biphenyl-4-yl}butanamide |
ChEMBL | CHEMBL1956144 |
DrugBank | |
ZINC | ZINC000073298364
|
PDB chain | 3u1y Chain B Residue 405
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.5.1.108: UDP-3-O-acyl-N-acetylglucosamine deacetylase. |
|
|
|