Structure of PDB 3ryx Chain B Binding Site BS02 |
|
|
Ligand ID | RYX |
InChI | InChI=1S/C10H9F5N2O3S/c11-9(12,10(13,14)15)5-17-8(18)6-1-3-7(4-2-6)21(16,19)20/h1-4H,5H2,(H,17,18)(H2,16,19,20) |
InChIKey | XRWFNUPDTKOWTL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | N[S](=O)(=O)c1ccc(cc1)C(=O)NCC(F)(F)C(F)(F)F | OpenEye OEToolkits 1.7.2 | c1cc(ccc1C(=O)NCC(C(F)(F)F)(F)F)S(=O)(=O)N | ACDLabs 12.01 | O=S(=O)(N)c1ccc(C(=O)NCC(F)(F)C(F)(F)F)cc1 |
|
Formula | C10 H9 F5 N2 O3 S |
Name | N-(2,2,3,3,3-pentafluoropropyl)-4-sulfamoylbenzamide |
ChEMBL | CHEMBL75113 |
DrugBank | |
ZINC | ZINC000013603126
|
PDB chain | 3ryx Chain B Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|