Structure of PDB 3pdq Chain B Binding Site BS02 |
|
|
Ligand ID | KC6 |
InChI | InChI=1S/C14H14N4O3/c15-3-6-18-13(19)9-1-4-16-11(7-9)12-8-10(14(20)21)2-5-17-12/h1-2,4-5,7-8H,3,6,15H2,(H,18,19)(H,20,21) |
InChIKey | RTGDPYNAIULBPL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | NCCNC(=O)c1ccnc(c1)c2cc(ccn2)C(O)=O | ACDLabs 12.01 | O=C(O)c2ccnc(c1nccc(C(=O)NCCN)c1)c2 | OpenEye OEToolkits 1.7.0 | c1cnc(cc1C(=O)NCCN)c2cc(ccn2)C(=O)O |
|
Formula | C14 H14 N4 O3 |
Name | 4'-[(2-aminoethyl)carbamoyl]-2,2'-bipyridine-4-carboxylic acid |
ChEMBL | CHEMBL1615036 |
DrugBank | |
ZINC | ZINC000064754819
|
PDB chain | 3pdq Chain B Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|