Structure of PDB 3o2m Chain B Binding Site BS02 |
|
|
Ligand ID | 46A |
InChI | InChI=1S/C24H27N7/c1-4-5-14-31(24-25-17(2)15-18(3)26-24)16-19-10-12-20(13-11-19)21-8-6-7-9-22(21)23-27-29-30-28-23/h6-13,15H,4-5,14,16H2,1-3H3,(H,27,28,29,30) |
InChIKey | ZSQBWJVNWXAGKO-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | CCCCN(Cc1ccc(cc1)c2ccccc2c3n[nH]nn3)c4nc(cc(n4)C)C | CACTVS 3.370 | CCCCN(Cc1ccc(cc1)c2ccccc2c3n[nH]nn3)c4nc(C)cc(C)n4 | ACDLabs 12.01 | n1c(nnn1)c2c(cccc2)c3ccc(cc3)CN(c4nc(cc(n4)C)C)CCCC |
|
Formula | C24 H27 N7 |
Name | N-butyl-4,6-dimethyl-N-{[2'-(2H-tetrazol-5-yl)biphenyl-4-yl]methyl}pyrimidin-2-amine |
ChEMBL | CHEMBL90825 |
DrugBank | |
ZINC | ZINC000013832825
|
PDB chain | 3o2m Chain A Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
N156 D169 |
Catalytic site (residue number reindexed from 1) |
N150 D163 |
Enzyme Commision number |
2.7.11.24: mitogen-activated protein kinase. |
|
|
|