Structure of PDB 3kxo Chain B Binding Site BS02 |
|
|
Ligand ID | KXO |
InChI | InChI=1S/C19H19F4N3O/c20-15-3-1-2-13(10-15)17-5-4-14(11-24-17)18(27)25-16-6-8-26(9-7-16)12-19(21,22)23/h1-5,10-11,16H,6-9,12H2,(H,25,27) |
InChIKey | LPUCBGGXXIUBAZ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | c1cc(cc(c1)F)c2ccc(cn2)C(=O)NC3CCN(CC3)CC(F)(F)F | CACTVS 3.352 | Fc1cccc(c1)c2ccc(cn2)C(=O)NC3CCN(CC3)CC(F)(F)F |
|
Formula | C19 H19 F4 N3 O |
Name | 6-(3-fluorophenyl)-N-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]pyridine-3-carboxamide |
ChEMBL | CHEMBL1233897 |
DrugBank | |
ZINC | ZINC000058649826
|
PDB chain | 3kxo Chain B Residue 203
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|