Structure of PDB 3kme Chain B Binding Site BS02 |
|
|
Ligand ID | Z59 |
InChI | InChI=1S/C19H22N2O4S/c22-16(18(24)20-12-14-8-5-11-26-14)17(23)19(25)21-10-4-9-15(21)13-6-2-1-3-7-13/h1-3,5-8,11,15-17,22-23H,4,9-10,12H2,(H,20,24)/t15-,16-,17-/m1/s1 |
InChIKey | IJWSOCHVNGQZGZ-BRWVUGGUSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | O[C@H]([C@@H](O)C(=O)N1CCC[C@@H]1c2ccccc2)C(=O)NCc3sccc3 | CACTVS 3.352 | O[CH]([CH](O)C(=O)N1CCC[CH]1c2ccccc2)C(=O)NCc3sccc3 | OpenEye OEToolkits 1.7.0 | c1ccc(cc1)C2CCCN2C(=O)C(C(C(=O)NCc3cccs3)O)O | OpenEye OEToolkits 1.7.0 | c1ccc(cc1)[C@H]2CCCN2C(=O)[C@@H]([C@H](C(=O)NCc3cccs3)O)O |
|
Formula | C19 H22 N2 O4 S |
Name | (2R,3R)-2,3-dihydroxy-4-oxo-4-[(2R)-2-phenylpyrrolidin-1-yl]-N-(thiophen-2-ylmethyl)butanamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058650851
|
PDB chain | 3kme Chain B Residue 485
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.4.24.86: ADAM 17 endopeptidase. |
|
|
|