Structure of PDB 3kmc Chain B Binding Site BS02 |
|
|
Ligand ID | 403 |
InChI | InChI=1S/C20H24ClN3O4S/c21-15-5-1-2-6-16(15)23-9-11-24(12-10-23)20(28)18(26)17(25)19(27)22-8-7-14-4-3-13-29-14/h1-6,13,17-18,25-26H,7-12H2,(H,22,27)/t17-,18-/m1/s1 |
InChIKey | AZEKZZSSVLIPCQ-QZTJIDSGSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | c1ccc(c(c1)N2CCN(CC2)C(=O)C(C(C(=O)NCCc3cccs3)O)O)Cl | OpenEye OEToolkits 1.7.0 | c1ccc(c(c1)N2CCN(CC2)C(=O)[C@@H]([C@H](C(=O)NCCc3cccs3)O)O)Cl | CACTVS 3.352 | O[C@H]([C@@H](O)C(=O)N1CCN(CC1)c2ccccc2Cl)C(=O)NCCc3sccc3 | CACTVS 3.352 | O[CH]([CH](O)C(=O)N1CCN(CC1)c2ccccc2Cl)C(=O)NCCc3sccc3 |
|
Formula | C20 H24 Cl N3 O4 S |
Name | (2R,3R)-4-[4-(2-chlorophenyl)piperazin-1-yl]-2,3-dihydroxy-4-oxo-N-(2-thiophen-2-ylethyl)butanamide |
ChEMBL | CHEMBL605764 |
DrugBank | |
ZINC | ZINC000035984497
|
PDB chain | 3kmc Chain B Residue 485
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.4.24.86: ADAM 17 endopeptidase. |
|
|
|