Structure of PDB 3kkt Chain B Binding Site BS02 |
|
|
Ligand ID | 0CP |
InChI | InChI=1S/C18H24N2O3/c1-22-15-5-4-12(14-9-19-18(21)20-10-14)8-17(15)23-16-7-11-2-3-13(16)6-11/h4-5,8,11,13-14,16H,2-3,6-7,9-10H2,1H3,(H2,19,20,21)/t11-,13+,16+/m1/s1 |
InChIKey | LITNEAPWQHVPOK-FFSVYQOJSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | COc1ccc(cc1OC2CC3CCC2C3)C4CNC(=O)NC4 | CACTVS 3.352 OpenEye OEToolkits 1.7.0 | COc1ccc(cc1O[C@H]2C[C@@H]3CC[C@H]2C3)C4CNC(=O)NC4 | CACTVS 3.352 | COc1ccc(cc1O[CH]2C[CH]3CC[CH]2C3)C4CNC(=O)NC4 |
|
Formula | C18 H24 N2 O3 |
Name | 5-{3-[(1S,2S,4R)-bicyclo[2.2.1]hept-2-yloxy]-4-methoxyphenyl}tetrahydropyrimidin-2(1H)-one |
ChEMBL | CHEMBL1229569 |
DrugBank | |
ZINC | ZINC000003810794
|
PDB chain | 3kkt Chain B Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.4.53: 3',5'-cyclic-AMP phosphodiesterase. |
|
|
|