Structure of PDB 3jq9 Chain B Binding Site BS02 |
|
|
Ligand ID | AX1 |
InChI | InChI=1S/C14H9N5O3/c15-4-7-10-12(18-14(16)19-13(10)20)17-11(7)6-1-2-8-9(3-6)22-5-21-8/h1-3H,5H2,(H4,16,17,18,19,20) |
InChIKey | LODZVZHIOMSXPI-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | c1cc2c(cc1c3c(c4c([nH]3)N=C(NC4=O)N)C#N)OCO2 | CACTVS 3.341 | NC1=Nc2[nH]c(c3ccc4OCOc4c3)c(C#N)c2C(=O)N1 | ACDLabs 10.04 | N#Cc4c1C(=O)NC(=Nc1nc4c2ccc3OCOc3c2)N |
|
Formula | C14 H9 N5 O3 |
Name | 2-amino-6-(1,3-benzodioxol-5-yl)-4-oxo-4,7-dihydro-3H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile |
ChEMBL | CHEMBL568414 |
DrugBank | |
ZINC | ZINC000045260387
|
PDB chain | 3jq9 Chain B Residue 270
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|