Structure of PDB 3iu2 Chain B Binding Site BS02 |
|
|
Ligand ID | 096 |
InChI | InChI=1S/C23H30N4O3S/c1-25-9-11-26(12-10-25)8-4-5-17-13-20(28)21(30-2)14-19(17)23-27(22(29)16-31-23)18-6-3-7-24-15-18/h3,6-7,13-15,23,28H,4-5,8-12,16H2,1-2H3/t23-/m1/s1 |
InChIKey | XIVRJFPRMXOMLE-HSZRJFAPSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | COc1cc([C@H]2SCC(=O)N2c3cccnc3)c(CCCN4CCN(C)CC4)cc1O | ACDLabs 11.02 | O=C2N(c1cnccc1)C(SC2)c3cc(OC)c(O)cc3CCCN4CCN(C)CC4 | CACTVS 3.352 | COc1cc([CH]2SCC(=O)N2c3cccnc3)c(CCCN4CCN(C)CC4)cc1O | OpenEye OEToolkits 1.7.0 | CN1CCN(CC1)CCCc2cc(c(cc2[C@@H]3N(C(=O)CS3)c4cccnc4)OC)O | OpenEye OEToolkits 1.7.0 | CN1CCN(CC1)CCCc2cc(c(cc2C3N(C(=O)CS3)c4cccnc4)OC)O |
|
Formula | C23 H30 N4 O3 S |
Name | (2R)-2-{4-hydroxy-5-methoxy-2-[3-(4-methylpiperazin-1-yl)propyl]phenyl}-3-pyridin-3-yl-1,3-thiazolidin-4-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000039309890
|
PDB chain | 3iu2 Chain B Residue 2002
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|