Structure of PDB 3hyx Chain B Binding Site BS02 |
|
|
Ligand ID | AUK |
InChI | InChI=1S/C25H33NO2/c1-18(2)10-8-11-19(3)12-9-13-20(4)16-17-22-21(5)26(28)24-15-7-6-14-23(24)25(22)27/h6-7,10,12,14-16,28H,8-9,11,13,17H2,1-5H3/b19-12+,20-16+ |
InChIKey | FIHXCHBEHLCXEG-YEFHWUCQSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | O=C2c1c(cccc1)N(O)C(=C2C\C=C(/C)CC\C=C(/C)CC\C=C(/C)C)C | OpenEye OEToolkits 1.5.0 | CC1=C(C(=O)c2ccccc2N1O)C\C=C(/C)\CC\C=C(/C)\CCC=C(C)C | CACTVS 3.341 | CC(C)=CCCC(C)=CCCC(C)=CCC1=C(C)N(O)c2ccccc2C1=O | OpenEye OEToolkits 1.5.0 | CC1=C(C(=O)c2ccccc2N1O)CC=C(C)CCC=C(C)CCC=C(C)C | CACTVS 3.341 | CC(C)=CCCC(/C)=C/CCC(/C)=C/CC1=C(C)N(O)c2ccccc2C1=O |
|
Formula | C25 H33 N O2 |
Name | 1-hydroxy-2-methyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-4(1H)-one; Aurachin C |
ChEMBL | CHEMBL572434 |
DrugBank | |
ZINC |
|
PDB chain | 3hyx Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|