Structure of PDB 3hmv Chain B Binding Site BS02 |
|
|
Ligand ID | HBT |
InChI | InChI=1S/C17H17N3O4S/c1-9-6-7-11-13(8-9)25-17(14(11)15(18)21)19-16(22)10-4-2-3-5-12(10)20(23)24/h2-5,9H,6-8H2,1H3,(H2,18,21)(H,19,22)/t9-/m0/s1 |
InChIKey | OBHKTNMETRQPKN-VIFPVBQESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CC1CCc2c(sc(c2C(=O)N)NC(=O)c3ccccc3[N+](=O)[O-])C1 | CACTVS 3.341 | C[C@H]1CCc2c(C1)sc(NC(=O)c3ccccc3[N+]([O-])=O)c2C(N)=O | CACTVS 3.341 | C[CH]1CCc2c(C1)sc(NC(=O)c3ccccc3[N+]([O-])=O)c2C(N)=O | OpenEye OEToolkits 1.5.0 | C[C@H]1CCc2c(sc(c2C(=O)N)NC(=O)c3ccccc3[N+](=O)[O-])C1 | ACDLabs 10.04 | [O-][N+](=O)c1ccccc1C(=O)Nc2sc3c(c2C(=O)N)CCC(C3)C |
|
Formula | C17 H17 N3 O4 S |
Name | (6S)-6-methyl-2-{[(2-nitrophenyl)carbonyl]amino}-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000000687045
|
PDB chain | 3hmv Chain B Residue 530
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.4.53: 3',5'-cyclic-AMP phosphodiesterase. |
|
|
|