Structure of PDB 3h6w Chain B Binding Site BS02 |
|
|
Ligand ID | NS7 |
InChI | InChI=1S/C19H29N3O4S2/c1-14-11-16-12-17(15-5-3-4-6-15)20-27(23,24)19(16)13-18(14)28(25,26)22-9-7-21(2)8-10-22/h11,13,15,17,20H,3-10,12H2,1-2H3/t17-/m1/s1 |
InChIKey | KQAGZLQCEURCKJ-QGZVFWFLSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | CN1CCN(CC1)[S](=O)(=O)c2cc3c(C[CH](N[S]3(=O)=O)C4CCCC4)cc2C | ACDLabs 10.04 | O=S(=O)(c1c(cc2c(c1)S(=O)(=O)NC(C2)C3CCCC3)C)N4CCN(C)CC4 | OpenEye OEToolkits 1.5.0 | Cc1cc2c(cc1S(=O)(=O)N3CCN(CC3)C)S(=O)(=O)NC(C2)C4CCCC4 | OpenEye OEToolkits 1.5.0 | Cc1cc2c(cc1S(=O)(=O)N3CCN(CC3)C)S(=O)(=O)N[C@H](C2)C4CCCC4 | CACTVS 3.341 | CN1CCN(CC1)[S](=O)(=O)c2cc3c(C[C@@H](N[S]3(=O)=O)C4CCCC4)cc2C |
|
Formula | C19 H29 N3 O4 S2 |
Name | (3R)-3-cyclopentyl-6-methyl-7-[(4-methylpiperazin-1-yl)sulfonyl]-3,4-dihydro-2H-1,2-benzothiazine 1,1-dioxide |
ChEMBL | |
DrugBank | DB08305 |
ZINC | ZINC000039286895
|
PDB chain | 3h6w Chain B Residue 265
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|