Structure of PDB 3gc9 Chain B Binding Site BS02 |
|
|
Ligand ID | B45 |
InChI | InChI=1S/C28H27Cl3FN3O/c1-16(2)34-10-8-17(9-11-34)18-12-21(20-7-6-19(32)14-25(20)31)22-15-33-28(36)35(26(22)13-18)27-23(29)4-3-5-24(27)30/h3-7,12-14,16-17H,8-11,15H2,1-2H3,(H,33,36) |
InChIKey | KXNNHYBPDFMKQK-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | Fc1ccc(c(Cl)c1)c2cc(cc4c2CNC(=O)N4c3c(Cl)cccc3Cl)C5CCN(C(C)C)CC5 | OpenEye OEToolkits 1.5.0 | CC(C)N1CCC(CC1)c2cc(c3c(c2)N(C(=O)NC3)c4c(cccc4Cl)Cl)c5ccc(cc5Cl)F | CACTVS 3.341 | CC(C)N1CCC(CC1)c2cc3N(C(=O)NCc3c(c2)c4ccc(F)cc4Cl)c5c(Cl)cccc5Cl |
|
Formula | C28 H27 Cl3 F N3 O |
Name | 5-(2-chloro-4-fluorophenyl)-1-(2,6-dichlorophenyl)-7-[1-(1-methylethyl)piperidin-4-yl]-3,4-dihydroquinazolin-2(1H)-one |
ChEMBL | CHEMBL328242 |
DrugBank | |
ZINC | ZINC000026675213
|
PDB chain | 3gc9 Chain B Residue 365
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|