Structure of PDB 3foe Chain B Binding Site BS02 |
|
|
Ligand ID | NFX |
InChI | InChI=1S/C17H17ClFN3O3/c18-13-14-10(5-12(19)15(13)21-4-3-8(20)6-21)16(23)11(17(24)25)7-22(14)9-1-2-9/h5,7-9H,1-4,6,20H2,(H,24,25)/t8-/m1/s1 |
InChIKey | QGPKADBNRMWEQR-MRVPVSSYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | N[C@@H]1CCN(C1)c2c(F)cc3C(=O)C(=CN(C4CC4)c3c2Cl)C(O)=O | OpenEye OEToolkits 1.5.0 | c1c2c(c(c(c1F)N3CCC(C3)N)Cl)N(C=C(C2=O)C(=O)O)C4CC4 | ACDLabs 10.04 | Fc2c(c(Cl)c1N(C=C(C(=O)O)C(=O)c1c2)C3CC3)N4CCC(N)C4 | CACTVS 3.341 | N[CH]1CCN(C1)c2c(F)cc3C(=O)C(=CN(C4CC4)c3c2Cl)C(O)=O | OpenEye OEToolkits 1.5.0 | c1c2c(c(c(c1F)N3CC[C@H](C3)N)Cl)N(C=C(C2=O)C(=O)O)C4CC4 |
|
Formula | C17 H17 Cl F N3 O3 |
Name | 7-[(3R)-3-aminopyrrolidin-1-yl]-8-chloro-1-cyclopropyl-6-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid; Clinafloxacin |
ChEMBL | CHEMBL113334 |
DrugBank | |
ZINC | ZINC000001278767
|
PDB chain | 3foe Chain F Residue 0
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
5.6.2.2: DNA topoisomerase (ATP-hydrolyzing). |
|
|
|