Structure of PDB 3ewj Chain B Binding Site BS02 |
|
|
Ligand ID | 642 |
InChI | InChI=1S/C29H24N2O4/c32-27(33)23-15-29(23)16-26(31-28(29)34)19-10-12-21(13-11-19)35-17-20-14-25(18-6-2-1-3-7-18)30-24-9-5-4-8-22(20)24/h1-14,23,26H,15-17H2,(H,31,34)(H,32,33)/t23-,26+,29-/m1/s1 |
InChIKey | BFZXMIUWGSTUAL-ZSOKXDGFSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | O=C5NC(c4ccc(OCc2c3ccccc3nc(c1ccccc1)c2)cc4)CC56C(C(=O)O)C6 | CACTVS 3.341 | OC(=O)[C@H]1C[C@@]12C[C@H](NC2=O)c3ccc(OCc4cc(nc5ccccc45)c6ccccc6)cc3 | OpenEye OEToolkits 1.5.0 | c1ccc(cc1)c2cc(c3ccccc3n2)COc4ccc(cc4)[C@@H]5C[C@@]6(C[C@@H]6C(=O)O)C(=O)N5 | OpenEye OEToolkits 1.5.0 | c1ccc(cc1)c2cc(c3ccccc3n2)COc4ccc(cc4)C5CC6(CC6C(=O)O)C(=O)N5 | CACTVS 3.341 | OC(=O)[CH]1C[C]12C[CH](NC2=O)c3ccc(OCc4cc(nc5ccccc45)c6ccccc6)cc3 |
|
Formula | C29 H24 N2 O4 |
Name | (1S,3R,6S)-4-oxo-6-{4-[(2-phenylquinolin-4-yl)methoxy]phenyl}-5-azaspiro[2.4]heptane-1-carboxylic acid |
ChEMBL | |
DrugBank | DB07189 |
ZINC | ZINC000040891582
|
PDB chain | 3ewj Chain B Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.4.24.86: ADAM 17 endopeptidase. |
|
|
|