Structure of PDB 3epw Chain B Binding Site BS02 |
|
|
Ligand ID | JMQ |
InChI | InChI=1S/C12H16N4O4/c17-4-7-11(19)8(18)3-16(7)2-6-1-13-10-9(6)14-5-15-12(10)20/h1,5,7-8,11,13,17-19H,2-4H2,(H,14,15,20)/t7-,8+,11-/m1/s1 |
InChIKey | OKGGSJRJIFFOGK-VHSKPIJISA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | OC[C@@H]1[C@@H](O)[C@@H](O)CN1Cc2c[nH]c3C(=O)NC=Nc23 | ACDLabs 12.01 | O=C2NC=Nc1c(cnc12)CN3C(C(O)C(O)C3)CO | OpenEye OEToolkits 1.7.0 | c1c(c2c([nH]1)C(=O)NC=N2)CN3CC(C(C3CO)O)O | OpenEye OEToolkits 1.7.0 | c1c(c2c([nH]1)C(=O)NC=N2)C[N@]3C[C@@H]([C@@H]([C@H]3CO)O)O | CACTVS 3.370 | OC[CH]1[CH](O)[CH](O)CN1Cc2c[nH]c3C(=O)NC=Nc23 |
|
Formula | C12 H16 N4 O4 |
Name | 7-(((2R,3R,4S)-3,4-dihydroxy-2-(hydroxymethyl)pyrrolidin-1-yl)methyl)-3H-pyrrolo[3,2-d]pyrimidin-4(5H)-one |
ChEMBL | CHEMBL493456 |
DrugBank | |
ZINC | ZINC000038878792
|
PDB chain | 3epw Chain B Residue 1003
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|