Structure of PDB 3dop Chain B Binding Site BS02 |
|
|
Ligand ID | BDT |
InChI | InChI=1S/C19H30O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h12,14-17,21H,3-11H2,1-2H3/t12-,14+,15+,16+,17+,18+,19+/m1/s1 |
InChIKey | NVKAWKQGWWIWPM-MISPCMORSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | C[C@]12CCC(=O)C[C@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@@H]4O)C | CACTVS 3.341 | C[C]12CC[CH]3[CH](CC[CH]4CC(=O)CC[C]34C)[CH]1CC[CH]2O | CACTVS 3.341 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4CC(=O)CC[C@]34C)[C@@H]1CC[C@@H]2O | OpenEye OEToolkits 1.5.0 | CC12CCC(=O)CC1CCC3C2CCC4(C3CCC4O)C | ACDLabs 10.04 | O=C2CC1CCC3C(C1(C)CC2)CCC4(C3CCC4O)C |
|
Formula | C19 H30 O2 |
Name | 5-beta-DIHYDROTESTOSTERONE; (5beta,8alpha,17beta)-17-hydroxyandrostan-3-one |
ChEMBL | CHEMBL373357 |
DrugBank | DB07447 |
ZINC | ZINC000003814418
|
PDB chain | 3dop Chain B Residue 980
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
D53 Y58 K87 E120 |
Catalytic site (residue number reindexed from 1) |
D52 Y57 K86 E119 |
Enzyme Commision number |
1.3.1.3: Delta(4)-3-oxosteroid 5beta-reductase. |
|
|
|