Structure of PDB 3cwd Chain B Binding Site BS02 |
|
|
Ligand ID | LNA |
InChI | InChI=1S/C18H31NO4/c1-2-3-4-5-8-11-14-17(19(22)23)15-12-9-6-7-10-13-16-18(20)21/h8,11,15H,2-7,9-10,12-14,16H2,1H3,(H,20,21)/b11-8-,17-15+ |
InChIKey | LELVHAQTWXTCLY-XYWKCAQWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | CCCCC\C=C/CC(=C/CCCCCCCC(O)=O)\[N+]([O-])=O | OpenEye OEToolkits 1.5.0 | CCCCC\C=C/C/C(=C\CCCCCCCC(=O)O)/[N+](=O)[O-] | OpenEye OEToolkits 1.5.0 | CCCCCC=CCC(=CCCCCCCCC(=O)O)[N+](=O)[O-] | CACTVS 3.341 | CCCCCC=CCC(=CCCCCCCCC(O)=O)[N+]([O-])=O | ACDLabs 10.04 | [O-][N+](=O)/C(=C/CCCCCCCC(=O)O)C\C=C/CCCCC |
|
Formula | C18 H31 N O4 |
Name | (9E,12Z)-10-nitrooctadeca-9,12-dienoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000004654921
|
PDB chain | 3cwd Chain B Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|