Structure of PDB 3bmn Chain B Binding Site BS02 |
|
|
Ligand ID | AX3 |
InChI | InChI=1S/C6H10N6/c7-4-10-5(8)12-6(11-4)9-3-1-2-3/h3H,1-2H2,(H5,7,8,9,10,11,12) |
InChIKey | LVQDKIWDGQRHTE-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | n1c(nc(nc1N)NC2CC2)N | CACTVS 3.341 | Nc1nc(N)nc(NC2CC2)n1 | OpenEye OEToolkits 1.5.0 | C1CC1Nc2nc(nc(n2)N)N |
|
Formula | C6 H10 N6 |
Name | N~2~-cyclopropyl-1,3,5-triazine-2,4,6-triamine |
ChEMBL | CHEMBL1231107 |
DrugBank | |
ZINC | ZINC000000001239
|
PDB chain | 3bmn Chain B Residue 270
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|