Structure of PDB 3arn Chain B Binding Site BS02 |
|
|
Ligand ID | MSJ |
InChI | InChI=1S/C17H23N3O5S/c1-17(2,19-26(23,24)14-7-4-3-5-8-14)10-6-12-25-13-20-11-9-15(21)18-16(20)22/h3-5,7-9,11,19H,6,10,12-13H2,1-2H3,(H,18,21,22) |
InChIKey | RMYLCQFHDYJCJN-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | CC(C)(CCCOCN1C=CC(=O)NC1=O)NS(=O)(=O)c2ccccc2 | ACDLabs 12.01 | O=S(=O)(c1ccccc1)NC(C)(C)CCCOCN2C=CC(=O)NC2=O | CACTVS 3.370 | CC(C)(CCCOCN1C=CC(=O)NC1=O)N[S](=O)(=O)c2ccccc2 |
|
Formula | C17 H23 N3 O5 S |
Name | N-{5-[(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)methoxy]-2-methylpentan-2-yl}benzenesulfonamide |
ChEMBL | CHEMBL1234485 |
DrugBank | |
ZINC | ZINC000058649536
|
PDB chain | 3arn Chain C Residue 165
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|