Structure of PDB 2znq Chain B Binding Site BS02 |
|
|
Ligand ID | 401 |
InChI | InChI=1S/C21H21F4NO4/c1-3-13(20(28)29)8-12-4-7-18(30-2)14(9-12)11-26-19(27)16-6-5-15(10-17(16)22)21(23,24)25/h4-7,9-10,13H,3,8,11H2,1-2H3,(H,26,27)(H,28,29)/t13-/m0/s1 |
InChIKey | BDLLIPYDNFENMY-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | CC[CH](Cc1ccc(OC)c(CNC(=O)c2ccc(cc2F)C(F)(F)F)c1)C(O)=O | OpenEye OEToolkits 1.5.0 | CC[C@@H](Cc1ccc(c(c1)CNC(=O)c2ccc(cc2F)C(F)(F)F)OC)C(=O)O | ACDLabs 10.04 | FC(F)(F)c1ccc(c(F)c1)C(=O)NCc2cc(ccc2OC)CC(C(=O)O)CC | OpenEye OEToolkits 1.5.0 | CCC(Cc1ccc(c(c1)CNC(=O)c2ccc(cc2F)C(F)(F)F)OC)C(=O)O | CACTVS 3.341 | CC[C@@H](Cc1ccc(OC)c(CNC(=O)c2ccc(cc2F)C(F)(F)F)c1)C(O)=O |
|
Formula | C21 H21 F4 N O4 |
Name | (2S)-2-{3-[({[2-fluoro-4-(trifluoromethyl)phenyl]carbonyl}amino)methyl]-4-methoxybenzyl}butanoic acid; (S)-2-{3-[(2-fluoro-4-trifluoromethylbenzoylamino)methyl]-4-methoxybenzyl} butyric acid |
ChEMBL | CHEMBL202609 |
DrugBank | DB07070 |
ZINC | ZINC000028569243
|
PDB chain | 2znq Chain B Residue 923
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|